C18H35Cl2N3O2 — CID 119891679
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119891679) has the molecular formula C18H35Cl2N3O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119891679 |
| Molecular Formula | C18H35Cl2N3O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2-propan-2-yloxyethyl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CC(C)OCCN1CCN(C(=O)C2CC3CCCCC3N2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H33N3O2.2ClH/c1-14(2)23-12-11-20-7-9-21(10-8-20)18(22)17-13-15-5-3-4-6-16(15)19-17;;/h14-17,19H,3-13H2,1-2H3;2*1H |
| InChIKey | WRIGYMGHPQCGOE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |