C15H25F2N3O — CID 119867026
2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone (PubChem CID 119867026) has the molecular formula C15H25F2N3O and a molecular weight of 301.38 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119867026 |
| Molecular Formula | C15H25F2N3O |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl-[4-(2,2-difluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC2CCCCC2N1)N1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C15H25F2N3O/c16-14(17)10-19-5-7-20(8-6-19)15(21)13-9-11-3-1-2-4-12(11)18-13/h11-14,18H,1-10H2 |
| InChIKey | CVGFOTJXEAIYNB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |