C18H23Cl2N5O3 — CID 120670408
2-amino-2-(4-methylphenyl)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;dihydrochloride (PubChem CID 120670408) has the molecular formula C18H23Cl2N5O3 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-amino-2-(4-methylphenyl)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-amino-2-(4-methylphenyl)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 120670408 |
| Molecular Formula | C18H23Cl2N5O3 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-amino-2-(4-methylphenyl)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]ethanone;dihydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)N2CCC(Nc3ccc([N+](=O)[O-])cn3)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H21N5O3.2ClH/c1-12-2-4-13(5-3-12)17(19)18(24)22-9-8-14(11-22)21-16-7-6-15(10-20-16)23(25)26;;/h2-7,10,14,17H,8-9,11,19H2,1H3,(H,20,21);2*1H |
| InChIKey | ICSNSHJTGUGXAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|