C14H23Cl2N5O3 — CID 119890640
2-methyl-3-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]propan-1-one;dihydrochloride (PubChem CID 119890640) has the molecular formula C14H23Cl2N5O3 and a molecular weight of 380.28 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119890640 |
| Molecular Formula | C14H23Cl2N5O3 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-methyl-3-(methylamino)-1-[3-[(5-nitro-2-pyridinyl)amino]pyrrolidin-1-yl]propan-1-one;dihydrochloride |
| SMILES | CNCC(C)C(=O)N1CCC(Nc2ccc([N+](=O)[O-])cn2)C1.Cl.Cl |
| InChI | InChI=1S/C14H21N5O3.2ClH/c1-10(7-15-2)14(20)18-6-5-11(9-18)17-13-4-3-12(8-16-13)19(21)22;;/h3-4,8,10-11,15H,5-7,9H2,1-2H3,(H,16,17);2*1H |
| InChIKey | YXZKIOZCDMCFDX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|