C8H10N4O3 — CID 16960192
N-methyl-2-[(5-nitro-2-pyridinyl)amino]acetamide (PubChem CID 16960192) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is N-methyl-2-[(5-nitro-2-pyridinyl)amino]acetamide.
| Compound Name | N-methyl-2-[(5-nitro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 16960192 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-methyl-2-[(5-nitro-2-pyridinyl)amino]acetamide |
| SMILES | CNC(=O)CNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C8H10N4O3/c1-9-8(13)5-11-7-3-2-6(4-10-7)12(14)15/h2-4H,5H2,1H3,(H,9,13)(H,10,11) |
| InChIKey | QYIYDBYHVCIGKG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|