C12H16N4O5 — CID 82032786
3-methyl-2-[[2-[(5-nitro-2-pyridinyl)amino]acetyl]amino]butanoic acid (PubChem CID 82032786) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-methyl-2-[[2-[(5-nitro-2-pyridinyl)amino]acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-[(5-nitro-2-pyridinyl)amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 82032786 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-methyl-2-[[2-[(5-nitro-2-pyridinyl)amino]acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CNc1ccc([N+](=O)[O-])cn1)C(=O)O |
| InChI | InChI=1S/C12H16N4O5/c1-7(2)11(12(18)19)15-10(17)6-14-9-4-3-8(5-13-9)16(20)21/h3-5,7,11H,6H2,1-2H3,(H,13,14)(H,15,17)(H,18,19) |
| InChIKey | QFLNXDUHMPCFSH-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|