C13H17N3O5S — CID 82032766
3-methyl-2-[3-[(5-nitro-2-pyridinyl)sulfanyl]propanoylamino]butanoic acid (PubChem CID 82032766) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is 3-methyl-2-[3-[(5-nitro-2-pyridinyl)sulfanyl]propanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[3-[(5-nitro-2-pyridinyl)sulfanyl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 82032766 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-methyl-2-[3-[(5-nitro-2-pyridinyl)sulfanyl]propanoylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CCSc1ccc([N+](=O)[O-])cn1)C(=O)O |
| InChI | InChI=1S/C13H17N3O5S/c1-8(2)12(13(18)19)15-10(17)5-6-22-11-4-3-9(7-14-11)16(20)21/h3-4,7-8,12H,5-6H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | VUNDEEQNUOZIHH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|