C22H28N2O5S — CID 164623747
(2S)-2-[3-[4-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]sulfanylpropanoylamino]-3-methylbutanoic acid (PubChem CID 164623747) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is (2S)-2-[3-[4-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]sulfanylpropanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[3-[4-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]sulfanylpropanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 164623747 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (2S)-2-[3-[4-[6-(2-methoxyethoxy)-3-pyridinyl]phenyl]sulfanylpropanoylamino]-3-methylbutanoic acid |
| SMILES | COCCOc1ccc(-c2ccc(SCCC(=O)N[C@H](C(=O)O)C(C)C)cc2)cn1 |
| InChI | InChI=1S/C22H28N2O5S/c1-15(2)21(22(26)27)24-19(25)10-13-30-18-7-4-16(5-8-18)17-6-9-20(23-14-17)29-12-11-28-3/h4-9,14-15,21H,10-13H2,1-3H3,(H,24,25)(H,26,27)/t21-/m0/s1 |
| InChIKey | PHVQRCQLDJVRSJ-NRFANRHFSA-N |
| XLogP | 3.48 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|