C10H12N2O4S2 — CID 22382883
4-[(5-nitro-2-pyridinyl)disulfanyl]pentanoic acid (PubChem CID 22382883) has the molecular formula C10H12N2O4S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanoic acid.
| Compound Name | 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 22382883 |
| Molecular Formula | C10H12N2O4S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanoic acid |
| SMILES | CC(CCC(=O)O)SSc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H12N2O4S2/c1-7(2-5-10(13)14)17-18-9-4-3-8(6-11-9)12(15)16/h3-4,6-7H,2,5H2,1H3,(H,13,14) |
| InChIKey | PRPUZAGHPOFJRJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|