C10H13N3O3S2 — CID 88563057
4-[(5-nitro-2-pyridinyl)disulfanyl]pentanamide (PubChem CID 88563057) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanamide.
| Compound Name | 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanamide |
|---|---|
| PubChem CID | 88563057 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 4-[(5-nitro-2-pyridinyl)disulfanyl]pentanamide |
| SMILES | CC(CCC(N)=O)SSc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H13N3O3S2/c1-7(2-4-9(11)14)17-18-10-5-3-8(6-12-10)13(15)16/h3,5-7H,2,4H2,1H3,(H2,11,14) |
| InChIKey | SITMFNICIUKZDR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|