About chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate
chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate (PubChem CID 135304033) has the molecular formula C8H7ClN2O4S2
and a molecular weight of 294.74 g/mol. Its IUPAC name is chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate.
Molecular Properties
| Compound Name | chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate |
| PubChem CID | 135304033 |
| Molecular Formula | C8H7ClN2O4S2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 293.95 |
| IUPAC Name | chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate |
| SMILES | O=C(CCSSc1ccc([N+](=O)[O-])cn1)OCl |
| InChI | InChI=1S/C8H7ClN2O4S2/c9-15-8(12)3-4-16-17-7-2-1-6(5-10-7)11(13)14/h1-2,5H,3-4H2 |
| InChIKey | RHDQVTGKPUGSIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate?
The IUPAC name of chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate (CID 135304033) is chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate.
What is the SMILES notation for chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate?
The canonical SMILES for chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate is O=C(CCSSc1ccc([N+](=O)[O-])cn1)OCl.
What is the InChIKey of chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate?
The InChIKey is RHDQVTGKPUGSIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O4S2/c9-15-8(12)3-4-16-17-7-2-1-6(5-10-7)11(13)14/h1-2,5H,3-4H2.
What are the key properties of chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate?
chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate has a molecular weight of 294.74 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 3-[(5-nitro-2-pyridinyl)disulfanyl]propanoate is sourced from PubChem (CID 135304033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).