C19H20Cl2N4O8S4 — CID 135304096
3-[(5-nitro-2-pyridinyl)disulfanyl]butan-2-yl carbonochloridate;1-[(5-nitro-2-pyridinyl)disulfanyl]propan-2-yl carbonochloridate (PubChem CID 135304096) has the molecular formula C19H20Cl2N4O8S4 and a molecular weight of 631.56 g/mol. Its IUPAC name is 3-[(5-nitro-2-pyridinyl)disulfanyl]butan-2-yl carbonochloridate;1-[(5-nitro-2-pyridinyl)disulfanyl]propan-2-yl carbonochloridate.
| Compound Name | 3-[(5-nitro-2-pyridinyl)disulfanyl]butan-2-yl carbonochloridate;1-[(5-nitro-2-pyridinyl)disulfanyl]propan-2-yl carbonochloridate |
|---|---|
| PubChem CID | 135304096 |
| Molecular Formula | C19H20Cl2N4O8S4 |
| Molecular Weight | 631.56 g/mol |
| Exact Mass | 629.95 |
| IUPAC Name | 3-[(5-nitro-2-pyridinyl)disulfanyl]butan-2-yl carbonochloridate;1-[(5-nitro-2-pyridinyl)disulfanyl]propan-2-yl carbonochloridate |
| SMILES | CC(CSSc1ccc([N+](=O)[O-])cn1)OC(=O)Cl.CC(OC(=O)Cl)C(C)SSc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H11ClN2O4S2.C9H9ClN2O4S2/c1-6(17-10(11)14)7(2)18-19-9-4-3-8(5-12-9)13(15)16;1-6(16-9(10)13)5-17-18-8-3-2-7(4-11-8)12(14)15/h3-7H,1-2H3;2-4,6H,5H2,1H3 |
| InChIKey | AYQFRRBYHSCWCL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 164.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.56 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|