C16H23N3O6S2 — CID 177441512
(2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(5-nitro-2-pyridinyl)disulfanyl]methyl]pentanoic acid (PubChem CID 177441512) has the molecular formula C16H23N3O6S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(5-nitro-2-pyridinyl)disulfanyl]methyl]pentanoic acid.
| Compound Name | (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(5-nitro-2-pyridinyl)disulfanyl]methyl]pentanoic acid |
|---|---|
| PubChem CID | 177441512 |
| Molecular Formula | C16H23N3O6S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (2S,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(5-nitro-2-pyridinyl)disulfanyl]methyl]pentanoic acid |
| SMILES | CC[C@H](CSSc1ccc([N+](=O)[O-])cn1)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H23N3O6S2/c1-5-10(13(14(20)21)18-15(22)25-16(2,3)4)9-26-27-12-7-6-11(8-17-12)19(23)24/h6-8,10,13H,5,9H2,1-4H3,(H,18,22)(H,20,21)/t10-,13+/m1/s1 |
| InChIKey | DMLYUFFTXJFBQH-MFKMUULPSA-N |
| XLogP | 3.73 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|