About tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate
tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 177199447) has the molecular formula C12H13N5O4S2
and a molecular weight of 355.40 g/mol. Its IUPAC name is tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| PubChem CID | 177199447 |
| Molecular Formula | C12H13N5O4S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nnc(Sc2ccc([N+](=O)[O-])cn2)s1 |
| InChI | InChI=1S/C12H13N5O4S2/c1-12(2,3)21-10(18)14-9-15-16-11(23-9)22-8-5-4-7(6-13-8)17(19)20/h4-6H,1-3H3,(H,14,15,18) |
| InChIKey | BCASPXHPUNSAHN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (CID 177199447) is tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate is CC(C)(C)OC(=O)Nc1nnc(Sc2ccc([N+](=O)[O-])cn2)s1.
What is the InChIKey of tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate?
The InChIKey is BCASPXHPUNSAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O4S2/c1-12(2,3)21-10(18)14-9-15-16-11(23-9)22-8-5-4-7(6-13-8)17(19)20/h4-6H,1-3H3,(H,14,15,18).
What are the key properties of tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate?
tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate has a molecular weight of 355.40 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate is sourced from PubChem (CID 177199447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).