C12H13N5O4S2 — CID 177199447
tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate (PubChem CID 177199447) has the molecular formula C12H13N5O4S2 and a molecular weight of 355.40 g/mol. Its IUPAC name is tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 177199447 |
| Molecular Formula | C12H13N5O4S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | tert-butyl N-[5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nnc(Sc2ccc([N+](=O)[O-])cn2)s1 |
| InChI | InChI=1S/C12H13N5O4S2/c1-12(2,3)21-10(18)14-9-15-16-11(23-9)22-8-5-4-7(6-13-8)17(19)20/h4-6H,1-3H3,(H,14,15,18) |
| InChIKey | BCASPXHPUNSAHN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|