C13H8FN5O2S2 — CID 18290214
N-(4-fluorophenyl)-5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 18290214) has the molecular formula C13H8FN5O2S2 and a molecular weight of 349.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(4-fluorophenyl)-5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18290214 |
| Molecular Formula | C13H8FN5O2S2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | N-(4-fluorophenyl)-5-[(5-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Sc2nnc(Nc3ccc(F)cc3)s2)nc1 |
| InChI | InChI=1S/C13H8FN5O2S2/c14-8-1-3-9(4-2-8)16-12-17-18-13(23-12)22-11-6-5-10(7-15-11)19(20)21/h1-7H,(H,16,17) |
| InChIKey | BKVWIHHTRNXSPY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|