C15H19N5O4S — CID 86596570
tert-butyl N-[4-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 86596570) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 86596570 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | tert-butyl N-[4-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc(CCNc2ccc([N+](=O)[O-])cn2)cs1 |
| InChI | InChI=1S/C15H19N5O4S/c1-15(2,3)24-14(21)19-13-18-10(9-25-13)6-7-16-12-5-4-11(8-17-12)20(22)23/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)(H,18,19,21) |
| InChIKey | CVHJKUODTKHPOW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|