C11H11BN2O4S2 — CID 145294913
CID 145294913 (PubChem CID 145294913) has the molecular formula C11H11BN2O4S2 and a molecular weight of 310.16 g/mol.
| Compound Name | CID 145294913 |
|---|---|
| PubChem CID | 145294913 |
| Molecular Formula | C11H11BN2O4S2 |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCC1(SSc2ccc([N+](=O)[O-])cn2)CCC1 |
| InChI | InChI=1S/C11H11BN2O4S2/c12-10(15)18-7-11(4-1-5-11)20-19-9-3-2-8(6-13-9)14(16)17/h2-3,6H,1,4-5,7H2 |
| InChIKey | CJOQXEUCKIBVTO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|