C13H16N6O4 — CID 3868853
2-(methylaminomethyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 3868853) has the molecular formula C13H16N6O4 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-(methylaminomethyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(methylaminomethyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3868853 |
| Molecular Formula | C13H16N6O4 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-(methylaminomethyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | CNCc1nc(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)co1 |
| InChI | InChI=1S/C13H16N6O4/c1-14-7-12-18-10(8-23-12)13(20)16-5-4-15-11-3-2-9(6-17-11)19(21)22/h2-3,6,8,14H,4-5,7H2,1H3,(H,15,17)(H,16,20) |
| InChIKey | NZGJJSUWQVATKE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|