C23H18N8S — CID 58882081
6-[2-[[4-[(E)-cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 58882081) has the molecular formula C23H18N8S and a molecular weight of 438.52 g/mol. Its IUPAC name is 6-[2-[[4-[(E)-cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[4-[(E)-cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58882081 |
| Molecular Formula | C23H18N8S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 6-[2-[[4-[(E)-cyano-(4-phenyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#C/C(=C1\NC(c2ccccc2)=CS1)c1ccnc(NCCNc2ccc(C#N)cn2)n1 |
| InChI | InChI=1S/C23H18N8S/c24-12-16-6-7-21(29-14-16)26-10-11-28-23-27-9-8-19(31-23)18(13-25)22-30-20(15-32-22)17-4-2-1-3-5-17/h1-9,14-15,30H,10-11H2,(H,26,29)(H,27,28,31)/b22-18- |
| InChIKey | MKBQCIIQPQOEAM-PYCFMQQDSA-N |
| XLogP | 3.79 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|