C18H14ClN5S — CID 69311145
(2Z)-2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(cyclopropylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 69311145) has the molecular formula C18H14ClN5S and a molecular weight of 367.87 g/mol. Its IUPAC name is (2Z)-2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(cyclopropylamino)pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(cyclopropylamino)pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69311145 |
| Molecular Formula | C18H14ClN5S |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | (2Z)-2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-(cyclopropylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/NC(c2ccccc2Cl)=CS1)c1ccnc(NC2CC2)n1 |
| InChI | InChI=1S/C18H14ClN5S/c19-14-4-2-1-3-12(14)16-10-25-17(23-16)13(9-20)15-7-8-21-18(24-15)22-11-5-6-11/h1-4,7-8,10-11,23H,5-6H2,(H,21,22,24)/b17-13+ |
| InChIKey | ZOQMGUMVCKBRDE-GHRIWEEISA-N |
| XLogP | 4.23 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|