About 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile
2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 69310019) has the molecular formula C19H25N5S
and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile |
| PubChem CID | 69310019 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | CC(C)(C)C1=CSC(=C(C#N)c2ccnc(NC3CCCCC3)n2)N1 |
| InChI | InChI=1S/C19H25N5S/c1-19(2,3)16-12-25-17(24-16)14(11-20)15-9-10-21-18(23-15)22-13-7-5-4-6-8-13/h9-10,12-13,24H,4-8H2,1-3H3,(H,21,22,23) |
| InChIKey | PGWKQKZVIACKQC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile?
The IUPAC name of 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile (CID 69310019) is 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile.
What is the SMILES notation for 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile?
The canonical SMILES for 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile is CC(C)(C)C1=CSC(=C(C#N)c2ccnc(NC3CCCCC3)n2)N1.
What is the InChIKey of 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile?
The InChIKey is PGWKQKZVIACKQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N5S/c1-19(2,3)16-12-25-17(24-16)14(11-20)15-9-10-21-18(23-15)22-13-7-5-4-6-8-13/h9-10,12-13,24H,4-8H2,1-3H3,(H,21,22,23).
What are the key properties of 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile?
2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile has a molecular weight of 355.51 g/mol, XLogP of 4.64, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butyl-3H-1,3-thiazol-2-ylidene)-2-[2-(cyclohexylamino)pyrimidin-4-yl]acetonitrile is sourced from PubChem (CID 69310019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).