C14H10F5N5S — CID 24885021
(2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-thiazol-2-ylidene]acetonitrile (PubChem CID 24885021) has the molecular formula C14H10F5N5S and a molecular weight of 375.33 g/mol. Its IUPAC name is (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-thiazol-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-thiazol-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 24885021 |
| Molecular Formula | C14H10F5N5S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(1,1,2,2,2-pentafluoroethyl)-3H-1,3-thiazol-2-ylidene]acetonitrile |
| SMILES | N#C/C(=C1\NC(C(F)(F)C(F)(F)F)=CS1)c1ccnc(NC2CC2)n1 |
| InChI | InChI=1S/C14H10F5N5S/c15-13(16,14(17,18)19)10-6-25-11(24-10)8(5-20)9-3-4-21-12(23-9)22-7-1-2-7/h3-4,6-7,24H,1-2H2,(H,21,22,23)/b11-8- |
| InChIKey | UNGRTTDDNSTKMC-FLIBITNWSA-N |
| XLogP | 3.62 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|