C19H17N5S — CID 58882163
(2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]acetonitrile (PubChem CID 58882163) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]acetonitrile.
| Compound Name | (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 58882163 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2E)-2-[2-(cyclopropylamino)pyrimidin-4-yl]-2-[4-(4-methylphenyl)-3H-1,3-thiazol-2-ylidene]acetonitrile |
| SMILES | Cc1ccc(C2=CS/C(=C(/C#N)c3ccnc(NC4CC4)n3)N2)cc1 |
| InChI | InChI=1S/C19H17N5S/c1-12-2-4-13(5-3-12)17-11-25-18(23-17)15(10-20)16-8-9-21-19(24-16)22-14-6-7-14/h2-5,8-9,11,14,23H,6-7H2,1H3,(H,21,22,24)/b18-15- |
| InChIKey | QYLUYFYMHHKKKB-SDXDJHTJSA-N |
| XLogP | 3.89 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|