C18H22N6OS — CID 69310010
2-(4-ethyl-3H-1,3-thiazol-2-ylidene)-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 69310010) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(4-ethyl-3H-1,3-thiazol-2-ylidene)-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-(4-ethyl-3H-1,3-thiazol-2-ylidene)-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69310010 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(4-ethyl-3H-1,3-thiazol-2-ylidene)-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | CCC1=CSC(=C(C#N)c2ccnc(NCCCN3CCCC3=O)n2)N1 |
| InChI | InChI=1S/C18H22N6OS/c1-2-13-12-26-17(22-13)14(11-19)15-6-8-21-18(23-15)20-7-4-10-24-9-3-5-16(24)25/h6,8,12,22H,2-5,7,9-10H2,1H3,(H,20,21,23) |
| InChIKey | KJAPBOSZQNYVIX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|