C22H21ClN6OS — CID 69311126
2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 69311126) has the molecular formula C22H21ClN6OS and a molecular weight of 452.97 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | 2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 69311126 |
| Molecular Formula | C22H21ClN6OS |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-[4-(2-chlorophenyl)-3H-1,3-thiazol-2-ylidene]-2-[2-[3-(2-oxopyrrolidin-1-yl)propylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#CC(=C1NC(c2ccccc2Cl)=CS1)c1ccnc(NCCCN2CCCC2=O)n1 |
| InChI | InChI=1S/C22H21ClN6OS/c23-17-6-2-1-5-15(17)19-14-31-21(27-19)16(13-24)18-8-10-26-22(28-18)25-9-4-12-29-11-3-7-20(29)30/h1-2,5-6,8,10,14,27H,3-4,7,9,11-12H2,(H,25,26,28) |
| InChIKey | IRIVSBCLEROWRG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|