C17H24N6OS — CID 67564157
1-[3-[[4-[(E)-amino-(4-ethyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]propyl]pyrrolidin-2-one (PubChem CID 67564157) has the molecular formula C17H24N6OS and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[3-[[4-[(E)-amino-(4-ethyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[4-[(E)-amino-(4-ethyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 67564157 |
| Molecular Formula | C17H24N6OS |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[3-[[4-[(E)-amino-(4-ethyl-3H-1,3-thiazol-2-ylidene)methyl]pyrimidin-2-yl]amino]propyl]pyrrolidin-2-one |
| SMILES | CCC1=CS/C(=C(/N)c2ccnc(NCCCN3CCCC3=O)n2)N1 |
| InChI | InChI=1S/C17H24N6OS/c1-2-12-11-25-16(21-12)15(18)13-6-8-20-17(22-13)19-7-4-10-23-9-3-5-14(23)24/h6,8,11,21H,2-5,7,9-10,18H2,1H3,(H,19,20,22)/b16-15+ |
| InChIKey | CFENWAMPXCVHQF-FOCLMDBBSA-N |
| XLogP | 2.07 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|