C17H27F3IN7O — CID 111772563
1-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111772563) has the molecular formula C17H27F3IN7O and a molecular weight of 529.35 g/mol. Its IUPAC name is 1-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111772563 |
| Molecular Formula | C17H27F3IN7O |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 1-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCNc1nccc(C(F)(F)F)n1.I |
| InChI | InChI=1S/C17H26F3N7O.HI/c1-2-21-15(22-7-4-12-27-11-3-5-14(27)28)24-9-10-25-16-23-8-6-13(26-16)17(18,19)20;/h6,8H,2-5,7,9-12H2,1H3,(H2,21,22,24)(H,23,25,26);1H |
| InChIKey | KNTVERYWVLRSIS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|