C17H22F3N7 — CID 111773138
1-ethyl-2-(2-pyridin-2-ylethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111773138) has the molecular formula C17H22F3N7 and a molecular weight of 381.41 g/mol. Its IUPAC name is 1-ethyl-2-(2-pyridin-2-ylethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-(2-pyridin-2-ylethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111773138 |
| Molecular Formula | C17H22F3N7 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 1-ethyl-2-(2-pyridin-2-ylethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ccccn1)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H22F3N7/c1-2-21-15(23-9-6-13-5-3-4-8-22-13)25-11-12-26-16-24-10-7-14(27-16)17(18,19)20/h3-5,7-8,10H,2,6,9,11-12H2,1H3,(H2,21,23,25)(H,24,26,27) |
| InChIKey | PMPSKAPKAIXUSW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|