C12H20F3IN6 — CID 111773683
2-methyl-1-propyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111773683) has the molecular formula C12H20F3IN6 and a molecular weight of 432.23 g/mol. Its IUPAC name is 2-methyl-1-propyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-propyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111773683 |
| Molecular Formula | C12H20F3IN6 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 2-methyl-1-propyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NCCNc1nccc(C(F)(F)F)n1.I |
| InChI | InChI=1S/C12H19F3N6.HI/c1-3-5-17-10(16-2)19-7-8-20-11-18-6-4-9(21-11)12(13,14)15;/h4,6H,3,5,7-8H2,1-2H3,(H2,16,17,19)(H,18,20,21);1H |
| InChIKey | TWJBDQKJWIERFH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|