C17H21F4IN6 — CID 111776443
1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111776443) has the molecular formula C17H21F4IN6 and a molecular weight of 512.29 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111776443 |
| Molecular Formula | C17H21F4IN6 |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-2-methyl-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1nccc(C(F)(F)F)n1)NCCc1cccc(F)c1.I |
| InChI | InChI=1S/C17H20F4N6.HI/c1-22-15(23-7-5-12-3-2-4-13(18)11-12)25-9-10-26-16-24-8-6-14(27-16)17(19,20)21;/h2-4,6,8,11H,5,7,9-10H2,1H3,(H2,22,23,25)(H,24,26,27);1H |
| InChIKey | HNLRCGFKRKCJRW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|