C17H18F6N6 — CID 111774452
2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111774452) has the molecular formula C17H18F6N6 and a molecular weight of 420.36 g/mol. Its IUPAC name is 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111774452 |
| Molecular Formula | C17H18F6N6 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1nccc(C(F)(F)F)n1)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F6N6/c1-24-14(28-10-11-3-2-4-12(9-11)16(18,19)20)26-7-8-27-15-25-6-5-13(29-15)17(21,22)23/h2-6,9H,7-8,10H2,1H3,(H2,24,26,28)(H,25,27,29) |
| InChIKey | XRABWTQUYZPZLK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|