C17H22F3IN6O — CID 111771517
2-methyl-1-(2-phenoxyethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111771517) has the molecular formula C17H22F3IN6O and a molecular weight of 510.30 g/mol. Its IUPAC name is 2-methyl-1-(2-phenoxyethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-phenoxyethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111771517 |
| Molecular Formula | C17H22F3IN6O |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 2-methyl-1-(2-phenoxyethyl)-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCNc1nccc(C(F)(F)F)n1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C17H21F3N6O.HI/c1-21-15(25-11-12-27-13-5-3-2-4-6-13)23-9-10-24-16-22-8-7-14(26-16)17(18,19)20;/h2-8H,9-12H2,1H3,(H2,21,23,25)(H,22,24,26);1H |
| InChIKey | TUCNZUBKAAMPLJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|