C19H31F3N6O — CID 109478212
1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 109478212) has the molecular formula C19H31F3N6O and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 109478212 |
| Molecular Formula | C19H31F3N6O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCNc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H31F3N6O/c1-2-23-16(27-14-18(9-13-29)7-4-3-5-8-18)25-11-12-26-17-24-10-6-15(28-17)19(20,21)22/h6,10,29H,2-5,7-9,11-14H2,1H3,(H2,23,25,27)(H,24,26,28) |
| InChIKey | MNQLWOSBCKKFRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|