C19H33N5O3S — CID 109478097
1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine (PubChem CID 109478097) has the molecular formula C19H33N5O3S and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 109478097 |
| Molecular Formula | C19H33N5O3S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(pyridin-3-ylsulfonylamino)ethyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C19H33N5O3S/c1-2-21-18(23-16-19(10-14-25)8-4-3-5-9-19)22-12-13-24-28(26,27)17-7-6-11-20-15-17/h6-7,11,15,24-25H,2-5,8-10,12-14,16H2,1H3,(H2,21,22,23) |
| InChIKey | ACBJPWOVLWRUKN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|