C20H33ClN4O3S — CID 109477540
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109477540) has the molecular formula C20H33ClN4O3S and a molecular weight of 445.03 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109477540 |
| Molecular Formula | C20H33ClN4O3S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H33ClN4O3S/c1-2-22-19(24-16-20(11-14-26)9-4-3-5-10-20)23-12-13-25-29(27,28)18-8-6-7-17(21)15-18/h6-8,15,25-26H,2-5,9-14,16H2,1H3,(H2,22,23,24) |
| InChIKey | CCONXGYRXMZUAI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|