C18H31ClIN5O4S — CID 111883640
tert-butyl N-[2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883640) has the molecular formula C18H31ClIN5O4S and a molecular weight of 575.90 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883640 |
| Molecular Formula | C18H31ClIN5O4S |
| Molecular Weight | 575.90 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | tert-butyl N-[2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc(Cl)c1)NCCNC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C18H30ClN5O4S.HI/c1-5-20-16(21-9-10-23-17(25)28-18(2,3)4)22-11-12-24-29(26,27)15-8-6-7-14(19)13-15;/h6-8,13,24H,5,9-12H2,1-4H3,(H,23,25)(H2,20,21,22);1H |
| InChIKey | UGEPLDNFEXVWEL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 120.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.90 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|