C9H14ClIN4O2S — CID 110917106
2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 110917106) has the molecular formula C9H14ClIN4O2S and a molecular weight of 404.66 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110917106 |
| Molecular Formula | C9H14ClIN4O2S |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | I.NC(N)=NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H13ClN4O2S.HI/c10-7-2-1-3-8(6-7)17(15,16)14-5-4-13-9(11)12;/h1-3,6,14H,4-5H2,(H4,11,12,13);1H |
| InChIKey | UGVBHJHWQUNYBB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|