C18H30ClN5O3S — CID 111009533
2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111009533) has the molecular formula C18H30ClN5O3S and a molecular weight of 431.99 g/mol. Its IUPAC name is 2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111009533 |
| Molecular Formula | C18H30ClN5O3S |
| Molecular Weight | 431.99 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[[N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\CCNS(=O)(=O)c1cccc(Cl)c1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C18H30ClN5O3S/c1-5-20-18(23(4)14-17(25)24(6-2)7-3)21-11-12-22-28(26,27)16-10-8-9-15(19)13-16/h8-10,13,22H,5-7,11-12,14H2,1-4H3,(H,20,21) |
| InChIKey | ZIMXBPWDPPMDIE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.99 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|