C15H24ClN3O2S — CID 111305705
1-[(3-chlorophenyl)methyl]-3-ethyl-2-(2-ethylsulfonylethyl)-1-methylguanidine (PubChem CID 111305705) has the molecular formula C15H24ClN3O2S and a molecular weight of 345.90 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(2-ethylsulfonylethyl)-1-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(2-ethylsulfonylethyl)-1-methylguanidine |
|---|---|
| PubChem CID | 111305705 |
| Molecular Formula | C15H24ClN3O2S |
| Molecular Weight | 345.90 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(2-ethylsulfonylethyl)-1-methylguanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)CC)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H24ClN3O2S/c1-4-17-15(18-9-10-22(20,21)5-2)19(3)12-13-7-6-8-14(16)11-13/h6-8,11H,4-5,9-10,12H2,1-3H3,(H,17,18) |
| InChIKey | VNSWLYZCBUCRNA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.90 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|