C20H26ClIN4O2 — CID 111305322
N-[2-[[[(3-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide (PubChem CID 111305322) has the molecular formula C20H26ClIN4O2 and a molecular weight of 516.81 g/mol. Its IUPAC name is N-[2-[[[(3-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide.
| Compound Name | N-[2-[[[(3-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
|---|---|
| PubChem CID | 111305322 |
| Molecular Formula | C20H26ClIN4O2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | N-[2-[[[(3-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]ethyl]-4-hydroxybenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(O)cc1)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C20H25ClN4O2.HI/c1-3-22-20(25(2)14-15-5-4-6-17(21)13-15)24-12-11-23-19(27)16-7-9-18(26)10-8-16;/h4-10,13,26H,3,11-12,14H2,1-2H3,(H,22,24)(H,23,27);1H |
| InChIKey | KDZBESSBCQKSBE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|