C15H25ClIN3O — CID 111305968
1-[(3-chlorophenyl)methyl]-3-ethyl-2-(3-methoxypropyl)-1-methylguanidine;hydroiodide (PubChem CID 111305968) has the molecular formula C15H25ClIN3O and a molecular weight of 425.74 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(3-methoxypropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(3-methoxypropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111305968 |
| Molecular Formula | C15H25ClIN3O |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-2-(3-methoxypropyl)-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C15H24ClN3O.HI/c1-4-17-15(18-9-6-10-20-3)19(2)12-13-7-5-8-14(16)11-13;/h5,7-8,11H,4,6,9-10,12H2,1-3H3,(H,17,18);1H |
| InChIKey | GTEGIRPZICDEDZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|