C22H36ClN5O2 — CID 111010211
2-[[N'-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide (PubChem CID 111010211) has the molecular formula C22H36ClN5O2 and a molecular weight of 438.02 g/mol. Its IUPAC name is 2-[[N'-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[[N'-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 111010211 |
| Molecular Formula | C22H36ClN5O2 |
| Molecular Weight | 438.02 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | 2-[[N'-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-N-ethylcarbamimidoyl]-methylamino]-N,N-diethylacetamide |
| SMILES | CCN/C(=N\CC(c1cccc(Cl)c1)N1CCOCC1)N(C)CC(=O)N(CC)CC |
| InChI | InChI=1S/C22H36ClN5O2/c1-5-24-22(26(4)17-21(29)27(6-2)7-3)25-16-20(28-11-13-30-14-12-28)18-9-8-10-19(23)15-18/h8-10,15,20H,5-7,11-14,16-17H2,1-4H3,(H,24,25) |
| InChIKey | MJWRJUSGOFWJMC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.02 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|