C15H18ClIN4O2S — CID 110917114
2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-phenylguanidine;hydroiodide (PubChem CID 110917114) has the molecular formula C15H18ClIN4O2S and a molecular weight of 480.76 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110917114 |
| Molecular Formula | C15H18ClIN4O2S |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CCNS(=O)(=O)c1cccc(Cl)c1)Nc1ccccc1 |
| InChI | InChI=1S/C15H17ClN4O2S.HI/c16-12-5-4-8-14(11-12)23(21,22)19-10-9-18-15(17)20-13-6-2-1-3-7-13;/h1-8,11,19H,9-10H2,(H3,17,18,20);1H |
| InChIKey | IIBLCVWOFLFLMP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|