C15H24ClIN4O2S — CID 111043993
N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111043993) has the molecular formula C15H24ClIN4O2S and a molecular weight of 486.81 g/mol. Its IUPAC name is N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111043993 |
| Molecular Formula | C15H24ClIN4O2S |
| Molecular Weight | 486.81 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | N'-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/CCNS(=O)(=O)c2cccc(Cl)c2)C1.I |
| InChI | InChI=1S/C15H23ClN4O2S.HI/c1-12-4-3-9-20(11-12)15(17)18-7-8-19-23(21,22)14-6-2-5-13(16)10-14;/h2,5-6,10,12,19H,3-4,7-9,11H2,1H3,(H2,17,18);1H |
| InChIKey | GMSADEHLENICMA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|