C17H29IN4O3S — CID 111811655
N'-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111811655) has the molecular formula C17H29IN4O3S and a molecular weight of 496.42 g/mol. Its IUPAC name is N'-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111811655 |
| Molecular Formula | C17H29IN4O3S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | N'-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | COCCNS(=O)(=O)c1cccc(C/N=C(\N)N2CCCC(C)C2)c1.I |
| InChI | InChI=1S/C17H28N4O3S.HI/c1-14-5-4-9-21(13-14)17(18)19-12-15-6-3-7-16(11-15)25(22,23)20-8-10-24-2;/h3,6-7,11,14,20H,4-5,8-10,12-13H2,1-2H3,(H2,18,19);1H |
| InChIKey | QHJOQNAPVUSOQV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|