C15H27IN4O3S — CID 111811705
2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111811705) has the molecular formula C15H27IN4O3S and a molecular weight of 470.38 g/mol. Its IUPAC name is 2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111811705 |
| Molecular Formula | C15H27IN4O3S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | COCCNS(=O)(=O)c1cccc(CN=C(N(C)C)N(C)C)c1.I |
| InChI | InChI=1S/C15H26N4O3S.HI/c1-18(2)15(19(3)4)16-12-13-7-6-8-14(11-13)23(20,21)17-9-10-22-5;/h6-8,11,17H,9-10,12H2,1-5H3;1H |
| InChIKey | MMYWWBIZCUJPPE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|