C16H26F3IN4O3S — CID 109474636
1-ethyl-2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109474636) has the molecular formula C16H26F3IN4O3S and a molecular weight of 538.37 g/mol. Its IUPAC name is 1-ethyl-2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109474636 |
| Molecular Formula | C16H26F3IN4O3S |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1-ethyl-2-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(S(=O)(=O)NCCOC)c1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C16H25F3N4O3S.HI/c1-3-20-15(21-8-7-16(17,18)19)22-12-13-5-4-6-14(11-13)27(24,25)23-9-10-26-2;/h4-6,11,23H,3,7-10,12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IHRWZBCEEBXKPT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|