C19H27ClN4O4S — CID 111398865
1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[3-(furan-2-ylmethoxy)propyl]guanidine (PubChem CID 111398865) has the molecular formula C19H27ClN4O4S and a molecular weight of 442.97 g/mol. Its IUPAC name is 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[3-(furan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[3-(furan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111398865 |
| Molecular Formula | C19H27ClN4O4S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[2-[(3-chlorophenyl)sulfonylamino]ethyl]-3-ethyl-2-[3-(furan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H27ClN4O4S/c1-2-21-19(22-9-5-12-27-15-17-7-4-13-28-17)23-10-11-24-29(25,26)18-8-3-6-16(20)14-18/h3-4,6-8,13-14,24H,2,5,9-12,15H2,1H3,(H2,21,22,23) |
| InChIKey | DJYFSNXDPABAKE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|