C16H31IN4O4S — CID 111400152
1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111400152) has the molecular formula C16H31IN4O4S and a molecular weight of 502.42 g/mol. Its IUPAC name is 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111400152 |
| Molecular Formula | C16H31IN4O4S |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 1-ethyl-3-[3-(ethylsulfonylamino)propyl]-2-[3-(furan-2-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCCNS(=O)(=O)CC.I |
| InChI | InChI=1S/C16H30N4O4S.HI/c1-3-17-16(18-9-6-11-20-25(21,22)4-2)19-10-7-12-23-14-15-8-5-13-24-15;/h5,8,13,20H,3-4,6-7,9-12,14H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | PUBZCSRADSEJRD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|