C18H32N4O3 — CID 111399205
N-[2-[[N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111399205) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111399205 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[3-(furan-2-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCCOCc1ccco1)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H32N4O3/c1-5-19-17(22-11-10-20-16(23)18(2,3)4)21-9-7-12-24-14-15-8-6-13-25-15/h6,8,13H,5,7,9-12,14H2,1-4H3,(H,20,23)(H2,19,21,22) |
| InChIKey | BIJQSNIRXXZFSM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|